مفنامیک اسید

از ویکی‌پدیا، دانشنامهٔ آزاد
پرش به: ناوبری، جستجو

{{Drugbox | verifiedrevid = 476997443 | IUPAC_name = 2-(2,3-dimethylphenyl)aminobenzoic acid | image = Mefenamic acid Structural Formulae V.1.svg | image2 = Mefenamic acid - 3D.png

| tradename = Ponstel, Ponstan | Drugs.com = monograph | MedlinePlus = a681028 | pregnancy_category = C (Australia, United States) | legal_status = ℞-only (U.S.), POM in UK | routes_of_administration = Oral

| bioavailability = 90% | protein_bound = 90% | metabolism = Hepatic (CYP2C9) | elimination_half-life = 2 hours | excretion = Renal and fecal

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 61-68-7 | ATC_prefix = M01 | ATC_suffix = AG01 | PubChem = 4044 | IUPHAR_ligand = 2593 | DrugBank_Ref =  YesY

| DrugBank = DB00784

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 3904 | UNII_Ref =  YesY | UNII = 367589PJ2C | KEGG_Ref =  YesY | KEGG = D00151 | ChEMBL_Ref =  YesY | ChEMBL = 686

| C=15 | H=15 | N=1 | O=2 | molecular_weight = 241.285 g/mol | smiles = O=C(O)c2c(Nc1cccc(c1C)C)cccc2 | InChI = 1/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) | InChIKey = HYYBABOKPJLUIN-UHFFFAOYAO | StdInChI_Ref =  YesY | StdInChI = 1S/C15H15NO2/c1-10-6-5-9-13(11(10)2)16-14-8-4-3-7-12(14)15(17)18/h3-9,16H,1-2H3,(H,17,18) | StdInChIKey_Ref =  YesY | StdInChIKey = HYYBABOKPJLUIN-UHFFFAOYSA-N

رده درمانی: داروهای ضد التهاب غیر استروئیدی

اشکال دارویی: کپسول

موارد مصرف[ویرایش]

مفنامیک اسید نوعی داروی ضدالتهاب غیراستروئیدی است که برای تسکین درد به خصوص دردهای دندان درد استفاده می‌شود.

مشخصات[ویرایش]

فرمول شیمیایی مفنامیک اسید C۱۵H۱۵NO۲ است. نقطه ذوب آن ۷۶ درجه سانتی‌گراد و درصد چسبندگی آن به پروتئین پلاسما ۹۰٪ است. مدفوع]] دفع می‌شود. نیمه عمر آن حدود ۲ ساعت است و به شکل خوراکی مصرف می‌شود.

عوارض جانبی[ویرایش]

مفنامیک اسید به خاطر اثراتی که روی دستگاه گوارشی می گذارد معروف است. بنابراین توصیه می‌شود به اندازهٔ تجویز شده از سوی پزشک مصرف شود. مفنامیک اسید بهتر است همراه با غذا یا شیر مصرف شود.

از آن‌جایی که این دارو در برخی موارد موجب خواب‌آلودگی یا بی حالی می‌شود، توصیه می‌شود پس از مصرف دارو از رانندگی و مصرف الکل دوری شود.

از پیایندهای جانبی خفیف مفنامیک اسید می‌توان به سردرد و حالت عصبانیت و استفراغ اشاره کرد. اثرات جانبی شدید مانند اسهال، استفراغ خونی، دید غیر واضح، جوش روی پوست و تحریکات پوستی، خارش، ورم، گلودرد و تب نیز ممکن است مشاهده گردد؛ که در آن صورت می‌بایست به پزشک مراجعه نمود.

داروهای ضدالتهاب غیراستروئیدی ممکن است فشار خون را بدتر کنند.

جستارهای وابسته[ویرایش]

منابع[ویرایش]

الگو:SAJADLF

  • مشارکت‌کنندگان ویکی‌پدیا، «Mefenamic acid»، ویکی‌پدیای انگلیسی، دانشنامهٔ آزاد (بازیابی در ۱۳ژوئیه ۲۰۱۱).