مبندازول

از ویکی‌پدیا، دانشنامهٔ آزاد
پرش به: ناوبری، جستجو

_name = methyl (5-benzoyl-1H-benzimidazol-2-yl)carbamate | image = Mebendazol.svg | width = 300

| tradename = | Drugs.com = monograph | MedlinePlus = a682315 | pregnancy_category = C | legal_status = | routes_of_administration = Oral

| bioavailability = ~2% | metabolism = Hepatic | elimination_half-life = 2.5 to 5.5 hours | excretion =

| CASNo_Ref =  YesY | CAS_number_Ref =  YesY | CAS_number = 31431-39-7 | ATC_prefix = P02 | ATC_suffix = CA01 | ATC_supplemental = QP52AC09 | PubChem = 4030 | DrugBank_Ref =  YesY

| DrugBank = DB00643

| ChemSpiderID_Ref =  YesY | ChemSpiderID = 3890 | UNII_Ref =  YesY | UNII = 81G6I5V05I | KEGG_Ref =  YesY | KEGG = D00368 | ChEBI_Ref =  YesY | ChEBI = 6704 | ChEMBL_Ref =  YesY | ChEMBL = 685

| C=16 | H=13 | N=3 | O=3 | molecular_weight = 295.293 g/mol | smiles = O=C(c2cc1c(nc(n1)NC(=O)OC)cc2)c3ccccc3 | InChI = 1/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21) | InChIKey = OPXLLQIJSORQAM-UHFFFAOYAP | StdInChI_Ref =  YesY | StdInChI = 1S/C16H13N3O3/c1-22-16(21)19-15-17-12-8-7-11(9-13(12)18-15)14(20)10-5-3-2-4-6-10/h2-9H,1H3,(H2,17,18,19,21) | StdInChIKey_Ref =  YesY | StdInChIKey = OPXLLQIJSORQAM-UHFFFAOYSA-N | melting_point = 288.5 }}

مبندازول (با x) یک داروی بنزایمیدازول با اثر درمانی بر روی بیماری‌های ایجاد شده توسط کرم هاست. این دارو اثر درمانی روی کرمک، کرم‌های گرد، کرم‌های نواری، کرم‌های قلابدار و کرم‌های شلاقی دارد.

مکانیسم اثر[ویرایش]

مبندازول باعث بی حرکتی و مرگ کرم‌ها توسط مهار انتخابی و غیر قابل برگشت جذب گلوکز در آنهاست.این دارو همچنین روی میکروتوبول ها اثر میگذارد. مبندازول جذب روده‌ای خوبی ندارد و پس از مصرف زیاد، مقدارزیادی از آن بدون تغییر در مدفوع یافت می‌شود. دارو اثردرمانی خود را به آهستگی( غالبا ظرف سه روز) نشان می‌دهد. مبندازول برداشت گلوكز و ساير مواد غذايي داراي وزن مولكولي كم را در كرمهاي حساس مهار مي‌سازد و ذخاير گليكوژن را (كه براي تكثير و بقاي اين كرمها لازم است ) تخليه مي‌كند. طيف اثر اين دارو گسترده است و ممكن است در آلودگيهاي چندگانه مفيد باشد

مبندازول به‌عنوان يك داروي انتخابي در درمان آسكارياز، كاپيلارياز، انتروبياز و تريكورياز به كار مي‌رود.منیع

عوارض جانبی[ویرایش]

به دلیل جذب محدود در روده، این دارو تنها عوارض جانبی مختصری از جمله درد شکمی و اسهال از خود نشان می‌دهد. درصورت مصرف همزمان با مترونیدازول، احتمال بروز نشانگان استیونس-جانسون وجود دارد

منابع[ویرایش]

Wikipedia contributors، "Mebendazole،" Wikipedia, The Free Encyclopedia, http://en.wikipedia.org/w/index.php?title=Mebendazole&oldid=326557305 (accessed November 19, 2009).