اف دی-سی اورنج شماره ۱

از ویکی‌پدیا، دانشنامهٔ آزاد
پرش به: ناوبری، جستجو

{{Chembox | ImageFile=Orange No. 1.svg | IUPACName = FD&C Orange Number 1 | OtherNames = Acid orange 20
Orange I
Sodium 4-[2-(4-oxonaphthalen-1-ylidene)hydrazin-1-yl]benzenesulfonate | Section1 = {{Chembox Identifiers | CASNo = 523-44-4 | CASNo_Ref =  YesY | CASNo_Comment = 4-{2-[(1E)-1-ylidene]-1-yl} | PubChem = 23666138 | PubChem_Ref =  YesY[PubChem] | PubChem_Comment = 4-{2-[(1E)-1-ylidene]-1-yl} | PubChem1 = 23721617 | PubChem1_Ref =  YesY[PubChem] | PubChem1_Comment = 4-{2-[(1Z)-1-ylidene]-1-yl} | ChemSpiderID = 7844542 | ChemSpiderID_Ref =  YesY | ChemSpiderID_Comment = 4-{2-[(1E)-1-ylidene]-1-yl} | ChemSpiderID1 = 14466524 | ChemSpiderID1_Ref =  YesY | ChemSpiderID1_Comment = 4-{2-[(1Z)-1-ylidene]-1-yl} | EINECS = 208-346-6 | RTECS = DB7085000 | Beilstein = 3826844 | SMILES = [Na+].[O-]S(=O)(=O)C1=CC=C(NN=C2C=CC(=O)C3=C2C=CC=C3)C=C1 | StdInChI = 1S/C16H12N2O4S.Na/c19-16-10-9-15(13-3-1-2-4-14(13)16)18-17-11-5-7-12(8-6-11)23(20,21)22;/h1-10,17H,(H,20,21,22);/q;+1/p-1 | StdInChI_Ref =  YesY | StdInChIKey = HMWJVUNISIEXFR-UHFFFAOYSA-M | StdInChIKey_Ref =  YesY }} | Section2 = ! style="background: #F8EABA; text-align: center;" colspan="2" | خصوصیات |- | فرمول مولکولی | C16H11N2NaO4S |- | جرم مولی | ۳۵۰٫۳۲ g mol−1 |- | Section3 = ! style="background: #F8EABA; text-align: center;" colspan="2" | خطرات |-





| شماره‌های نگهداری | S۲۲, S24/25 |- }} اف دی-سی اورنج شماره ۱ (به انگلیسی: FD&C Orange Number 1) یک ترکیب شیمیایی با شناسه پاب‌کم ۲۳۶۶۶۱۳۸ است.

جستارهای وابسته[ویرایش]

منابع[ویرایش]