اندیس نظر آباد

از ویکی‌پدیا، دانشنامهٔ آزاد
پرش به ناوبری پرش به جستجو
نظر آباد
موقعیت
استاناستان کرمان
شهرحوالی رفسنجان
فاصله تا نزدیک‌ترین روستانظرآباد کیلومتر
مشخصات فنی معدن
تعداد نمونه گرفته شده۹۹ عدد
مشخصات فنی کانی
کانی سنگین۴۴
آنالیزFire Assay
فرمول شیمیاییAu+ Fe2O3+Cu2CO3(OH)2+Cu4H4Si4O۱۰(OH)8
پاراژنزطلا، هماتیت، مالاکیت، کریزوکولا.
سنگ معدن
ژنزآذرین
سنگ میزبانولکانیکهای ائوسن. پیروکلاستیکهای داسیتی و تراورتن.
سن سنگ میزبانائوسن
توضیحات۱۲نمونه کانی سنگین حاوی ذرات طلای ناتیو گزارش شده‌است که یکی از نمونه‌ها حاوی ۳ ذره طلا بوده‌است.
زلزله
وضعیت لرزه‌خیزی ناحیهغیر فعال
نام اندیسنظر آباد
نوع اندیسفلزی
نام مادهطلا
نوع مادهفلزی

نظر آباد یک اندیس فلزی است که در حوالی شهر رفسنجان استان کرمان قرار دارد و مادهٔ معدنی موجود در آن، طلا است.سنگ میزبان این اندیس ولکانیکهای ائوسن. پیروکلاستیکهای داسیتی و تراورتن. است و دیرینگی آن به دوران ائوسن می‌رسد. در این اندیس، پاراژنز‌های طلا، هماتیت، مالاکیت، کریزوکولا. یافت می‌شوند.[۱]

جستارهای وابسته[ویرایش]

منابع[ویرایش]

  1. «اطلاعات اندیس‌های ایران». پایگاه ملی داده‌های علوم زمین کشور. بایگانی‌شده از اصلی در ۱۳ اکتبر ۲۰۱۲. دریافت‌شده در ۲۲ تیر ۱۳۹۱.