پرش به محتوا

تفاوت میان نسخه‌های «کلرهگزیدین»

بدون خلاصه ویرایش
جز (ربات: مرتب‌سازی رده‌ها؛ زیباسازی)
| Watchedfields = changed
| verifiedrevid = 464187733
| IUPAC_name = ''N''',''N<nowiki>'''''</nowiki>''-hexane-1,6-diylbis[''N''-(4-chlorophenyl)(imidodicarbonimidic diamide)]
| image = Chlorhexidin.svg
| width = 250
<!--Clinical data-->
| tradename = Hibiclens
| Drugs.com = {{drugs.com|pro|chlorhexidine}}
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 55-56-1
| ATC_prefix = A01
| ATC_suffix = AB03
| ATC_supplemental = {{ATC|B05|CA02}}, {{ATC|D08|AC02}}, {{ATC|D09|AA12}} (dressing), {{ATC|R02|AA05}}, {{ATC|S01|AX09}}, {{ATC|S02|AA09}}, {{ATC|S03|AA04}}
| PubChem = 5353524
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00878
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2612
| UNII_Ref = {{fdacite|correct|FDA}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07668
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 3614
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 790
<!--Chemical data-->
| C=22 | H=30 | Cl=2 | N=10
| molecular_weight = 505.446 g/mol
| smiles = Clc2ccc(NC(=N/C(=N/CCCCCC/N=C(/N=C(N)Nc1ccc(Cl)cc1)N)N)N)cc2
| InChI = 1/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34)
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H30Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
'''کلرهگزیدین''' {{انگلیسی|Chlorhexidine}}
