Jump to content

منوی ناوبری

تفاوت میان نسخه‌های «تریس (۲٫۳-بروموپروپیل) فسفات»

بدون خلاصه ویرایش
جز (ویرایش با ابرابزار)
{{Chembox
| ImageFile = tris(2,3-dibromopropyl) phosphate.svg
| ImageSize = 200px
| IUPACName = Tris(2,3-dibromopropyl) phosphate
| OtherNames = Fyrol HB 32
| Section1 = {{Chembox Identifiers
| CASNo = 126-72-7
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 31356
| ChemSpiderID = 29089
| SMILES = BrCC(Br)COP(=O)(OCC(Br)CBr)OCC(Br)CBr
| InChI = InChI=1S/C9H15Br6O4P/c10-1-7(13)4-17-20(16,18-5-8(14)2-11)19-6-9(15)3-12/h7-9H,1-6H2
}}
| Section2 = {{Chembox Properties
| C=9|H=15|Br=6|O=4|P=1
| Appearance =
| Density = 2.24 g/cm<sup>3</sup><ref name=GESTIS>{{GESTIS|ZVG=24340}}</ref>
| MeltingPt =
| BoilingPt =
| Solubility = Insoluble<ref name=GESTIS/>
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt = > {{convert|110|C|F}}<ref name=GESTIS/>
| Autoignition =
}}
}}
 
'''تریس(۲٫۳-بروموپروپیل) فسفات''' {{انگلیسی|Tris(2,3-dibromopropyl) phosphate}} یک [[ترکیب شیمیایی]] با [[پاب‌کم|شناسه پاب‌کم]] ۳۱۳۵۶ است.