پرش به محتوا

تفاوت میان نسخه‌های «ایندیناویر»

ابرابزار
برچسب‌ها: ویرایش با تلفن همراه ویرایش با نرم‌افزار تلفن همراه ویرایش توسط نرم‌افزار اندروید
(ابرابزار)
{{Infobox drug
| Verifiedfields = changed
| verifiedrevid = 477168143۴۷۷۱۶۸۱۴۳
| IUPAC_name = (2''S'')-1-[(2''S'',4''R'')-4-benzyl-2-hydroxy-4-<nowiki/>{[(1''S'',2''R'')-2-hydroxy-2,3-dihydro-1''H''-inden-1-yl]carbamoyl}butyl]-''N-tert''-butyl-4-(pyridin-3-ylmethyl)piperazine-2-carboxamide
| image = Indinavir structure.svg
| width = 251
| image2 = Indinavir ball-and-stick.png
 
 
| tradename = Crixivan
| pregnancy_US = C
| licence_EU = yes
| legal_status =
| routes_of_administration = خوراکی
 
 
| bioavailability = ~۶۵٪
| metabolism = [[کبد|کبدی]] از طریق [[CYP3A4]]
| elimination_half-life = ۱٫۸ ± ۰٫۴ ساعت
 
 
| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 150378۱۵۰۳۷۸-17۱۷-9۹
| ATC_prefix = J05
| ATC_suffix = AE02
| ATC_supplemental =
| PubChem = 5362440۵۳۶۲۴۴۰
| DrugBank_Ref = {{Drugbankcite|correct|drugbank}}
| DrugBank = DB00224
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| ChemSpiderID = 4515036۴۵۱۵۰۳۶
| NIAID_ChemDB = 005824۰۰۵۸۲۴
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 9MG78X43ZT
| KEGG = C07051
| ChEBI_Ref = {{Ebicite|correct|EBI}}
| ChEBI = 44032۴۴۰۳۲
| ChEMBL_Ref = {{Ebicite|changed|EBI}}
| ChEMBL = 540914۵۴۰۹۱۴
| PDB_ligand = MK1
 
| C=36 | H=47 | N=5 | O=4۴
 
| C=36 | H=47 | N=5 | O=4
| smiles = CC(C)(C)NC(=O)[C@@H]1CN(CCN1C[C@H](C[C@@H](Cc2ccccc2)C(=O)N[C@H]3c4ccccc4C[C@H]3O)O)Cc5cccnc5
| StdInChI_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = CBVCZFGXHXORBI-PXQQMZJSSA-N
}}
'''ایندیناویر''' ({{Lang-en|Indinavir}}) با نام تجاری Crixivan، ساخته شده توسط شرکت [[مرک اند کو.]] یک [[بازدارنده‌های پروتئاز|مهارکننده پروتئاز]] است که به عنوان بخشی از درمان ضد ویروسی بسیار فعال برای [[درمان اچ‌آی‌وی/ایدز]] به کار می‌رود. این پودر سفید محلول به صورت خوراکی در ترکیب با سایر داروهای ضد ویروسی تجویز می‌شود. این دارو از عملکرد طبیعی پروتئاز جلوگیری می‌کند. در نتیجه، ویروس‌های HIV نمی‌توانند تکثیر شوند و باعث کاهش بار ویروسی می‌شود. ایندیناویر تجاری که به فروش می‌رسد ایندیناویر بدون آب است که با یک آمین اضافی در ستون فقرات هیدروکسی اتیلن ایندیناویر است. این امر حلالیت و فراهمی زیستی آن را افزایش می‌دهد و مصرف آن را برای کاربران آسان می‌کند. این ماده به منظور مهار پروتئاز در ویروس HIV به صورت مصنوعی تولید شد.<ref name=":12">{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/indinavir#section=Mechanism-of-Action|title=Indinavir|last=Pubchem|website=pubchem.ncbi.nlm.nih.gov|language=en|access-date=2018-10-22}}</ref>
 
در حال حاضر، استفاده از آن در درمان [[ایدز]] به دلیل عوارض جانبی آن سفارش نمی‌شود. افزون بر این، به دلایل فراوانی از توسعه آن تا استفاده از آن بحث برانگیزبحث‌برانگیز است.
 
این دارو در سال ۱۹۹۱ ثبت شد و در سال ۱۹۹۶ برای کاربرد پزشکی تأیید شد.<ref name=Fis2006>{{cite book |last1=Fischer |first1=Jnos |last2=Ganellin |first2=C. Robin | name-list-style = vanc |title=Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495978-3-527-60749-5 |page=509 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA509 |language=en}}</ref>
 
== کاربرد پزشکی ==
ایندیناویر ایدز را درمان نمی‌کند، اما با کند کردن پیشرفت بیماری می‌تواند طول عمر فرد را برای چندین سال افزایش دهد. نوعی از ایندیناویر که به طوربه‌طور گسترده مورد استفاده و ایجاد شده توسط شرکت مرک است، سولفات ایندیناویر است. قرص‌ها از نمک‌های سولفات ایجاد شده و در دوزهای ۱۰۰، ۲۰۰، ۳۳۳ و ۴۰۰ میلی‌گرم ایندیناویر به فروش می‌رسند. معمولاً به عنوان یکی از سه دارو در درمان ترکیبی سه‌گانه برای ویروس HIV استفاده می‌شود.
 
کپسول‌های تجاری موجود باید در دمای ۱۵ تا ۳۰ درجه سانتی‌گراد نگهداری شوند؛ همچنین باید در ظرف محکم نگهداری شود تا از رطوبت دور باشد.باشد؛ بنابراین، پیشنهاد می‌شود که کاربران قرص‌ها را در بطری تهیه شده توسط سازنده نگهداری کنند و مواد خشک کنندهخشک‌کننده را حذف نکنند.
[[File:2avo_Indinavir.png|thumb|کمپلکس پروتآز HIV-1 با ایندیناویر. PDB entry {{PDBe|2avo}}<ref>{{cite journal | vauthors = Liu F, Boross PI, Wang YF, Tozser J, Louis JM, Harrison RW, Weber IT | title = Kinetic, stability, and structural changes in high-resolution crystal structures of HIV-1 protease with drug-resistant mutations L24I, I50V, and G73S | journal = Journal of Molecular Biology | volume = 354 | issue = 4 | pages = 789–800 | date = December 2005 | pmid = 16277992 | pmc = 1403828 | doi = 10.1016/j.jmb.2005.09.095 }}</ref>]]
 
ایندیناویر پس از مصرف به سرعت از بین می‌رود. ایندیناویر بدون افزایش نیاز به دوز بسیار دقیق ۴۰۰ میلی‌گرم هر هشت ساعت برای جلوگیری از ایجاد جهش‌های مقاوم در برابر HIV از جمله مقاومت در برابر سایر مهارکننده هایمهارکننده‌های پروتئاز دارد. ایندیناویر تقویت شده به دو کپسول ایندیناویر ۴۰۰ میلی‌گرم با ۱ تا ۲ کپسول ۱۰۰ میلی‌گرم ریتوناویر دو بار در روز نیاز دارد. در هر دو مورد، داروها باید با آب فراوان یک یا دو ساعت بعد از غذا مصرف شوند. پیشنهاد می‌شود که مصرف‌کنندگان دست‌کم ۱.۵۱٫۵ لیتر آب و مایعات در روز در هنگام مصرف دارو بنوشند. مصرف‌کنندگان مواد مخدر باید مصرف آب خود را به دلیل حلالیت کم ایندیناویر که می‌تواند باعث متبلور شدن آن شود، به میزان قابل توجهی افزایش دهند. محدودیت‌هایی در مورد نوع غذا که ممکن است همزمان با درمان ایندیناویر تقویت نشده مصرف شود وجود دارد. افزون بر این، به دلیل بار قرص و خطر سنگ کلیه، دیگر در ایالات متحده برای استفاده در درمان‌های اولیه پیشنهاد نمی‌شود.<ref name=":82">{{Cite news|url=https://www.rxlist.com/crixivan-drug.htm#indications|title=Crixivan (Indinavir Sulfate): Side Effects, Interactions, Warning, Dosage & Uses|work=RxList|access-date=2018-11-08|language=en}}</ref>
 
== مقاومت ویروسی ==
بسیاری از مردم در مورد امیدوار بودن بیش از حد به ایندیناویر به دلیل وقایع قبلی که با [[زیدوودین]] اتفاق افتاده بود، تردید داشتند. مقاومت ویروسی در برابر دارو باعث می‌شود که دارو بی‌فایده شود زیرا ویروس تکامل یافته و دارای سلول‌هایی است که قادر به مقاومت در برابر مهارکننده پروتئاز هستند. به منظور جلوگیری از این امر تا حد ممکن، برای مصرف‌کنندگان مهم است که به طوربه‌طور مداوم مقدار دقیق دارو را در زمان‌های اختصاصی مصرف کنند. این ترس از مقاومت ویروسی باعث شد بسیاری از مصرف‌کنندگان نسبت به این دارو احتیاط کنند.
 
== عوارض جانبی ==
شایع‌ترین عوارض جانبی ایندیناویر عبارتند از:
 
* اختلالات گوارشی (درد شکم، اسهال، تهوع و استفراغ)
* ضعف عمومی و [[خستگی]]
* نفرولیتیازیس/[[سنگ کلیه]] (تشکیل سنگ کلیه) که گاهی اوقات ممکن است منجر به شرایط شدیدتری از جمله [[نارسایی کلیه]] شود.
* تغییرات [[متابولیسم|متابولیک]] شامل [[چربی خون|هیپرلیپیدمی]] (افزایش [[کلسترول]] یا [[تری‌گلیسیرید]]) و [[هیپرگلیسمی|افزایش قند خون]]
* تغییرات در شکل بدن ([[لیپودیستروفی]]) ، که در اصطلاح عامیانه با نام ''شکم کریکس'' شناخته می‌شود.<ref>{{cite journal | vauthors = Capaldini L | title = Protease inhibitors' metabolic side effects: cholesterol, triglycerides, blood sugar, and "Crix belly." Interview with Lisa Capaldini, M.D. Interview by John S. James | journal = AIDS Treatment News | issue = 277 | pages = 1–4 | date = August 1997 | pmid = 11364559 }}</ref>
* افزایش سطح [[بیلی‌روبین]]، باعث زرد شدن پوست و بخش‌های سفید چشم می‌شود.<ref>{{Cite web |url= https://livertox.nih.gov/Indinavir.htm|title=Indinavir |website=livertox.nih.gov|access-date=2018-10-21}}</ref>
* تولید اکسید نیتروژن ادرار را مهار می‌کند و ممکن است تولید اکسید نیتریک را مهار کند.<ref>{{Cite news |url= https://www.medicalnewstoday.com/articles/315086.php |title=High bilirubin levels: Meaning, symptoms, and tests |last=MacGill |first=Markus | name-list-style = vanc |date=July 24, 2018|work=Medical News Today|access-date=2018-10-21 }}</ref>
* ناهنجاری‌های کلیوی، [[پیوری|لکوسیتوری]] استریل و کاهش تراوش مواد از نوع [[کراتینین]].<ref name="pmid16906281pmid 16906281">{{cite journal | vauthors = Eira M, Araujo M, Seguro AC | title = Urinary NO3 excretion and renal failure in indinavir-treated patients | journal = Brazilian Journal of Medical and Biological Research | volume = 39 | issue = 8 | pages = 1065–70 | date = August 2006 | pmid = 16906281 | doi = 10.1590/s0100-879x2006000800009 | doi-access = free }}</ref>
* عملکرد اندوتلیال را در مردان سالم HIV منفی به هم می‌زند و ممکن است بیماری [[تصلب شرایین]] را تسریع کند.<ref name="pmid16290967pmid 16290967">{{cite journal | vauthors = Shankar SS, Dubé MP, Gorski JC, Klaunig JE, Steinberg HO | title = Indinavir impairs endothelial function in healthy HIV-negative men | journal = American Heart Journal | volume = 150 | issue = 5 | pages = 933.e1–933.e7 | date = November 2005 | pmid = 16290967 | doi = 10.1016/j.ahj.2005.06.005 }}</ref>
 
== منابع ==
{{پانویس|چپ‌چین=بله}}
* {{یادکرد-ویکی|پیوند =//en.wikipedia.org/w/index.php?title=Indinavir&oldid=1037325110|عنوان = Indinavir|زبان =انگلیسی|بازیابی =۲۴ اوت ۲۰۲۱}}
{{خرد|دارو}}
[[رده:الکل‌های نوع دوم]]
[[رده:ایندان‌ها]]
[[رده:ترکیبات ترت بوتیل]]
[[رده:پیریدین‌ها]]
[[رده:پیپرازین‌ها]]
[[رده:کربوکسامیدهاپیریدین‌ها]]
[[رده:ترکیبات ترت بوتیل]]
[[رده:داروها با وضعیت قانونی نامشخص]]
[[رده:کربوکسامیدها]]
۲۷٬۳۲۸

ویرایش