سدیم لورت سولفات

از ویکی‌پدیا، دانشنامهٔ آزاد
پرش به: ناوبری، جستجو
سدیم لورت سولفات
Sodium laureth sulfate structure.png
شناساگرها
کوته‌نوشت‌ها SLES
شماره ثبت سی‌ای‌اس ۹۰۰۴-۸۲-۴ YesY
خصوصیات
فرمول مولکولی CH3(CH2)11(OCH2CH2)nOSO3Na
جرم مولی حدود 420 g/mol
(288.38 + 44.05n) g mol−1
خطرات
لوزی آتش
Special hazards (white): no codeNFPA 704 four-colored diamond
به استثنای جایی که اشاره شده‌است در غیر این صورت، داده‌ها برای مواد به وضعیت استانداردشان داده شده‌اند (در 25 °C (۷۷ °F)، ۱۰۰ kPa)
 YesY (بررسی) (چیست: YesY/N؟)
Infobox references

سدیم لورت سولفات (به انگلیسی: Sodium laureth sulfate) با نام اختصاری SLES[۱] و با فرمول شیمیایی CH۳(CH۲)۱۰CH۲(OCH۲CH۲)nOSO۳NaC12+2nH25+4nNaO4+nS یک ترکیب شیمیایی است؛ که جرم مولی آن ۴۲۰ g/mol می‌باشد.این ماده یک ماده فعال سطحی است که در بسیاری از شوینده‌های مصنوعی از جمله صابون، شامپو و خمیردندان مشاهده می‌شود.

جستارهای وابسته[ویرایش]

منابع[ویرایش]

  1. “SLES”. TheFreeDictionary.com. Retrieved 2015-10-27.