سدیم لورت سولفات

از ویکی‌پدیا، دانشنامهٔ آزاد
پرش به: ناوبری، جستجو
Sodium laureth sulfate
Sodium laureth sulfate structure.png
شناساگرها
شماره ثبت سی‌ای‌اس 9004-82-4 YesY
خصوصیات
فرمول مولکولی CH3(CH2)10CH2(OCH2CH2)nOSO3Na
C12+2nH25+4nNaO4+nS
جرم مولی around 420 g/mol
(288.38 + 44.05n) g mol−1
به استثنای جایی که اشاره شده‌است در غیر این صورت، داده‌ها برای مواد به وضعیت استانداردشان داده شده‌اند (در 25 °C (۷۷ °F)، ۱۰۰ kPa)
 YesY (بررسی) (چیست: YesY/N؟)
Infobox references

سدیم لورت سولفات (به انگلیسی: Sodium laureth sulfate) با فرمول شیمیایی CH۳(CH۲)۱۰CH۲(OCH۲CH۲)nOSO۳NaC12+2nH25+4nNaO4+nS یک ترکیب شیمیایی است. که جرم مولی آن ۴۲۰ g/mol می‌باشد.

جستارهای وابسته[ویرایش]

منابع[ویرایش]